C9H10INS — CID 134907917
2-iodo-1,3-dimethyl-2,1-benzothiazole (PubChem CID 134907917) has the molecular formula C9H10INS and a molecular weight of 291.16 g/mol. Its IUPAC name is 2-iodo-1,3-dimethyl-2,1-benzothiazole.
| Compound Name | 2-iodo-1,3-dimethyl-2,1-benzothiazole |
|---|---|
| PubChem CID | 134907917 |
| Molecular Formula | C9H10INS |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | 2-iodo-1,3-dimethyl-2,1-benzothiazole |
| SMILES | CC1=S(I)N(C)c2ccccc21 |
| InChI | InChI=1S/C9H10INS/c1-7-8-5-3-4-6-9(8)11(2)12(7)10/h3-6H,1-2H3 |
| InChIKey | BGZKZFQCNIIDHA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|