C8H9NOS — CID 142822965
1-methyl-3H-2,1-benzothiazole 2-oxide (PubChem CID 142822965) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is 1-methyl-3H-2,1-benzothiazole 2-oxide.
| Compound Name | 1-methyl-3H-2,1-benzothiazole 2-oxide |
|---|---|
| PubChem CID | 142822965 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 1-methyl-3H-2,1-benzothiazole 2-oxide |
| SMILES | CN1c2ccccc2CS1=O |
| InChI | InChI=1S/C8H9NOS/c1-9-8-5-3-2-4-7(8)6-11(9)10/h2-5H,6H2,1H3 |
| InChIKey | FYCYDOHRRYXTAE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |