About 5-methylphenazin-10-ide
5-methylphenazin-10-ide (PubChem CID 100992210) has the molecular formula C13H11N2-
and a molecular weight of 195.25 g/mol. Its IUPAC name is 5-methylphenazin-10-ide.
Molecular Properties
| Compound Name | 5-methylphenazin-10-ide |
| PubChem CID | 100992210 |
| Molecular Formula | C13H11N2- |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 5-methylphenazin-10-ide |
| SMILES | CN1c2ccccc2[N-]c2ccccc21 |
| InChI | InChI=1S/C13H11N2/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15/h2-9H,1H3/q-1 |
| InChIKey | ZUTBGWLQADWXRN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methylphenazin-10-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylphenazin-10-ide?
The IUPAC name of 5-methylphenazin-10-ide (CID 100992210) is 5-methylphenazin-10-ide.
What is the SMILES notation for 5-methylphenazin-10-ide?
The canonical SMILES for 5-methylphenazin-10-ide is CN1c2ccccc2[N-]c2ccccc21.
What is the InChIKey of 5-methylphenazin-10-ide?
The InChIKey is ZUTBGWLQADWXRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N2/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15/h2-9H,1H3/q-1.
What are the key properties of 5-methylphenazin-10-ide?
5-methylphenazin-10-ide has a molecular weight of 195.25 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylphenazin-10-ide is sourced from PubChem (CID 100992210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).