C17H17N — CID 144534632
(5R)-12-methyl-12-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6,8,10,13,15-hexaene (PubChem CID 144534632) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is (5R)-12-methyl-12-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6,8,10,13,15-hexaene.
| Compound Name | (5R)-12-methyl-12-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6,8,10,13,15-hexaene |
|---|---|
| PubChem CID | 144534632 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (5R)-12-methyl-12-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6,8,10,13,15-hexaene |
| SMILES | CN1c2ccccc2C2CC[C@H]2c2ccccc21 |
| InChI | InChI=1S/C17H17N/c1-18-16-8-4-2-6-14(16)12-10-11-13(12)15-7-3-5-9-17(15)18/h2-9,12-13H,10-11H2,1H3/t12-,13?/m1/s1 |
| InChIKey | MBAHASTYSSWTCS-PZORYLMUSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |