C15H14N2O — CID 118456170
10-methyl-9H-acridine-9-carboxamide (PubChem CID 118456170) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 10-methyl-9H-acridine-9-carboxamide.
| Compound Name | 10-methyl-9H-acridine-9-carboxamide |
|---|---|
| PubChem CID | 118456170 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 10-methyl-9H-acridine-9-carboxamide |
| SMILES | CN1c2ccccc2C(C(N)=O)c2ccccc21 |
| InChI | InChI=1S/C15H14N2O/c1-17-12-8-4-2-6-10(12)14(15(16)18)11-7-3-5-9-13(11)17/h2-9,14H,1H3,(H2,16,18) |
| InChIKey | JBSZXUOVBDBVDO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |