C10H9NO3 — CID 90463059
4-hydroxy-1-methyl-4H-quinoline-2,3-dione (PubChem CID 90463059) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-4H-quinoline-2,3-dione.
| Compound Name | 4-hydroxy-1-methyl-4H-quinoline-2,3-dione |
|---|---|
| PubChem CID | 90463059 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 4-hydroxy-1-methyl-4H-quinoline-2,3-dione |
| SMILES | CN1C(=O)C(=O)C(O)c2ccccc21 |
| InChI | InChI=1S/C10H9NO3/c1-11-7-5-3-2-4-6(7)8(12)9(13)10(11)14/h2-5,8,12H,1H3 |
| InChIKey | JPNUPRALXPMAQC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|