C20H16Br2N2O2 — CID 15733007
11,12-dibromo-9,14-dimethyl-9,14-diazapentacyclo[10.8.0.02,11.03,8.015,20]icosa-3,5,7,15,17,19-hexaene-10,13-dione (PubChem CID 15733007) has the molecular formula C20H16Br2N2O2 and a molecular weight of 476.17 g/mol. Its IUPAC name is 11,12-dibromo-9,14-dimethyl-9,14-diazapentacyclo[10.8.0.02,11.03,8.015,20]icosa-3,5,7,15,17,19-hexaene-10,13-dione.
| Compound Name | 11,12-dibromo-9,14-dimethyl-9,14-diazapentacyclo[10.8.0.02,11.03,8.015,20]icosa-3,5,7,15,17,19-hexaene-10,13-dione |
|---|---|
| PubChem CID | 15733007 |
| Molecular Formula | C20H16Br2N2O2 |
| Molecular Weight | 476.17 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | 11,12-dibromo-9,14-dimethyl-9,14-diazapentacyclo[10.8.0.02,11.03,8.015,20]icosa-3,5,7,15,17,19-hexaene-10,13-dione |
| SMILES | CN1C(=O)C2(Br)C(c3ccccc31)C1c3ccccc3N(C)C(=O)C12Br |
| InChI | InChI=1S/C20H16Br2N2O2/c1-23-13-9-5-3-7-11(13)15-16-12-8-4-6-10-14(12)24(2)18(26)20(16,22)19(15,21)17(23)25/h3-10,15-16H,1-2H3 |
| InChIKey | VWNVTZLPFHAXCC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.17 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|