C16H17NO4 — CID 101229135
methyl (6aS,7R,10aS)-7-hydroxy-5-methyl-6-oxo-10,10a-dihydro-7H-phenanthridine-6a-carboxylate (PubChem CID 101229135) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is methyl (6aS,7R,10aS)-7-hydroxy-5-methyl-6-oxo-10,10a-dihydro-7H-phenanthridine-6a-carboxylate.
| Compound Name | methyl (6aS,7R,10aS)-7-hydroxy-5-methyl-6-oxo-10,10a-dihydro-7H-phenanthridine-6a-carboxylate |
|---|---|
| PubChem CID | 101229135 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl (6aS,7R,10aS)-7-hydroxy-5-methyl-6-oxo-10,10a-dihydro-7H-phenanthridine-6a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)N(C)c3ccccc3[C@@H]1CC=C[C@H]2O |
| InChI | InChI=1S/C16H17NO4/c1-17-12-8-4-3-6-10(12)11-7-5-9-13(18)16(11,14(17)19)15(20)21-2/h3-6,8-9,11,13,18H,7H2,1-2H3/t11-,13+,16-/m0/s1 |
| InChIKey | AIYKVJULEJGBEL-GHJWDPDVSA-N |
| XLogP | 1.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|