C19H25NO3 — CID 25180548
methyl 1-cyclohexyl-2-oxo-3-(2-phenylethyl)azetidine-3-carboxylate (PubChem CID 25180548) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is methyl 1-cyclohexyl-2-oxo-3-(2-phenylethyl)azetidine-3-carboxylate.
| Compound Name | methyl 1-cyclohexyl-2-oxo-3-(2-phenylethyl)azetidine-3-carboxylate |
|---|---|
| PubChem CID | 25180548 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | methyl 1-cyclohexyl-2-oxo-3-(2-phenylethyl)azetidine-3-carboxylate |
| SMILES | COC(=O)C1(CCc2ccccc2)CN(C2CCCCC2)C1=O |
| InChI | InChI=1S/C19H25NO3/c1-23-18(22)19(13-12-15-8-4-2-5-9-15)14-20(17(19)21)16-10-6-3-7-11-16/h2,4-5,8-9,16H,3,6-7,10-14H2,1H3 |
| InChIKey | JHWNCXXBEFKQID-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|