C22H25NO2 — CID 97103863
methyl (2R,3R)-1-cyclohexyl-3-(4-phenylphenyl)aziridine-2-carboxylate (PubChem CID 97103863) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is methyl (2R,3R)-1-cyclohexyl-3-(4-phenylphenyl)aziridine-2-carboxylate.
| Compound Name | methyl (2R,3R)-1-cyclohexyl-3-(4-phenylphenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 97103863 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | methyl (2R,3R)-1-cyclohexyl-3-(4-phenylphenyl)aziridine-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](c2ccc(-c3ccccc3)cc2)N1C1CCCCC1 |
| InChI | InChI=1S/C22H25NO2/c1-25-22(24)21-20(23(21)19-10-6-3-7-11-19)18-14-12-17(13-15-18)16-8-4-2-5-9-16/h2,4-5,8-9,12-15,19-21H,3,6-7,10-11H2,1H3/t20-,21-,23?/m1/s1 |
| InChIKey | IORCSIWZIMABRA-OJOWTSHBSA-N |
| XLogP | 4.58 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|