C22H43NO2 — CID 91342907
ethane;methyl 1-methyl-2-phenylpiperidine-3-carboxylate (PubChem CID 91342907) has the molecular formula C22H43NO2 and a molecular weight of 353.59 g/mol. Its IUPAC name is ethane;methyl 1-methyl-2-phenylpiperidine-3-carboxylate.
| Compound Name | ethane;methyl 1-methyl-2-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 91342907 |
| Molecular Formula | C22H43NO2 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.33 |
| IUPAC Name | ethane;methyl 1-methyl-2-phenylpiperidine-3-carboxylate |
| SMILES | CC.CC.CC.CC.COC(=O)C1CCCN(C)C1c1ccccc1 |
| InChI | InChI=1S/C14H19NO2.4C2H6/c1-15-10-6-9-12(14(16)17-2)13(15)11-7-4-3-5-8-11;4*1-2/h3-5,7-8,12-13H,6,9-10H2,1-2H3;4*1-2H3 |
| InChIKey | MQKUDTQMIAILFL-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |