C14H16ClNO3 — CID 154856703
methyl (2S,3R)-1-(2-chloroacetyl)-2-phenylpyrrolidine-3-carboxylate (PubChem CID 154856703) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is methyl (2S,3R)-1-(2-chloroacetyl)-2-phenylpyrrolidine-3-carboxylate.
| Compound Name | methyl (2S,3R)-1-(2-chloroacetyl)-2-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 154856703 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | methyl (2S,3R)-1-(2-chloroacetyl)-2-phenylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN(C(=O)CCl)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H16ClNO3/c1-19-14(18)11-7-8-16(12(17)9-15)13(11)10-5-3-2-4-6-10/h2-6,11,13H,7-9H2,1H3/t11-,13-/m1/s1 |
| InChIKey | ASEIULWBPWNSRM-DGCLKSJQSA-N |
| XLogP | 1.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|