C13H14ClNO4 — CID 11737672
methyl (2S,4S)-3-(2-chloroacetyl)-2-phenyl-1,3-oxazolidine-4-carboxylate (PubChem CID 11737672) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is methyl (2S,4S)-3-(2-chloroacetyl)-2-phenyl-1,3-oxazolidine-4-carboxylate.
| Compound Name | methyl (2S,4S)-3-(2-chloroacetyl)-2-phenyl-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11737672 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | methyl (2S,4S)-3-(2-chloroacetyl)-2-phenyl-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CO[C@@H](c2ccccc2)N1C(=O)CCl |
| InChI | InChI=1S/C13H14ClNO4/c1-18-13(17)10-8-19-12(15(10)11(16)7-14)9-5-3-2-4-6-9/h2-6,10,12H,7-8H2,1H3/t10-,12-/m0/s1 |
| InChIKey | CZKULIJJDDPWNE-JQWIXIFHSA-N |
| XLogP | 1.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|