C17H22ClNO4 — CID 10759552
methyl (2R,4S)-2-tert-butyl-3-[(2R)-2-chloro-2-phenylacetyl]-1,3-oxazolidine-4-carboxylate (PubChem CID 10759552) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is methyl (2R,4S)-2-tert-butyl-3-[(2R)-2-chloro-2-phenylacetyl]-1,3-oxazolidine-4-carboxylate.
| Compound Name | methyl (2R,4S)-2-tert-butyl-3-[(2R)-2-chloro-2-phenylacetyl]-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10759552 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | methyl (2R,4S)-2-tert-butyl-3-[(2R)-2-chloro-2-phenylacetyl]-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1CO[C@H](C(C)(C)C)N1C(=O)[C@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C17H22ClNO4/c1-17(2,3)16-19(12(10-23-16)15(21)22-4)14(20)13(18)11-8-6-5-7-9-11/h5-9,12-13,16H,10H2,1-4H3/t12-,13+,16+/m0/s1 |
| InChIKey | AEEFGDYEQFSULC-WOSRLPQWSA-N |
| XLogP | 2.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|