C10H17NO4 — CID 45038525
methyl (4S)-2-tert-butyl-3-formyl-1,3-oxazolidine-4-carboxylate (PubChem CID 45038525) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is methyl (4S)-2-tert-butyl-3-formyl-1,3-oxazolidine-4-carboxylate.
| Compound Name | methyl (4S)-2-tert-butyl-3-formyl-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 45038525 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | methyl (4S)-2-tert-butyl-3-formyl-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1COC(C(C)(C)C)N1C=O |
| InChI | InChI=1S/C10H17NO4/c1-10(2,3)9-11(6-12)7(5-15-9)8(13)14-4/h6-7,9H,5H2,1-4H3/t7-,9?/m0/s1 |
| InChIKey | CUOGQSHIYFHDEM-JAVCKPHESA-N |
| XLogP | 0.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|