C10H17NO3S — CID 101232737
methyl (2R,4R)-2-tert-butyl-5,5-dideuterio-3-formyl-1,3-thiazolidine-4-carboxylate (PubChem CID 101232737) has the molecular formula C10H17NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is methyl (2R,4R)-2-tert-butyl-5,5-dideuterio-3-formyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (2R,4R)-2-tert-butyl-5,5-dideuterio-3-formyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 101232737 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl (2R,4R)-2-tert-butyl-5,5-dideuterio-3-formyl-1,3-thiazolidine-4-carboxylate |
| SMILES | [2H]C1([2H])S[C@H](C(C)(C)C)N(C=O)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C10H17NO3S/c1-10(2,3)9-11(6-12)7(5-15-9)8(13)14-4/h6-7,9H,5H2,1-4H3/t7-,9+/m0/s1/i5D2 |
| InChIKey | YHMVCGMRDPFPRT-VBUSCFJISA-N |
| XLogP | 1.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|