C11H19NO3S — CID 59896210
methyl (2R)-2-tert-butyl-3-formyl-4-methyl-1,3-thiazolidine-4-carboxylate (PubChem CID 59896210) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is methyl (2R)-2-tert-butyl-3-formyl-4-methyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl (2R)-2-tert-butyl-3-formyl-4-methyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 59896210 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | methyl (2R)-2-tert-butyl-3-formyl-4-methyl-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1(C)CS[C@H](C(C)(C)C)N1C=O |
| InChI | InChI=1S/C11H19NO3S/c1-10(2,3)8-12(7-13)11(4,6-16-8)9(14)15-5/h7-8H,6H2,1-5H3/t8-,11?/m1/s1 |
| InChIKey | PMGZJXSUJXMEKU-RZZZFEHKSA-N |
| XLogP | 1.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|