C9H15NO4 — CID 102337663
methyl (3R,5S)-5-formyl-2,3,5-trimethyl-1,2-oxazolidine-3-carboxylate (PubChem CID 102337663) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is methyl (3R,5S)-5-formyl-2,3,5-trimethyl-1,2-oxazolidine-3-carboxylate.
| Compound Name | methyl (3R,5S)-5-formyl-2,3,5-trimethyl-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102337663 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | methyl (3R,5S)-5-formyl-2,3,5-trimethyl-1,2-oxazolidine-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@@](C)(C=O)ON1C |
| InChI | InChI=1S/C9H15NO4/c1-8(6-11)5-9(2,7(12)13-4)10(3)14-8/h6H,5H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | HYMHTNZGHJEAQF-DTWKUNHWSA-N |
| XLogP | 0.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|