C10H14N2O5 — CID 602936
dimethyl 5-cyano-2,5-dimethyl-1,2-oxazolidine-3,3-dicarboxylate (PubChem CID 602936) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is dimethyl 5-cyano-2,5-dimethyl-1,2-oxazolidine-3,3-dicarboxylate.
| Compound Name | dimethyl 5-cyano-2,5-dimethyl-1,2-oxazolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 602936 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | dimethyl 5-cyano-2,5-dimethyl-1,2-oxazolidine-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C)(C#N)ON1C |
| InChI | InChI=1S/C10H14N2O5/c1-9(6-11)5-10(7(13)15-3,8(14)16-4)12(2)17-9/h5H2,1-4H3 |
| InChIKey | ZBJAJZJALVKGRG-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|