methyl 1,2,2-trimethylcyclopropane-1-carboxylate

C8H14O2 — CID 15129471

IUPACmethyl 1,2,2-trimethylcyclopropane-1-carboxylate
SMILESCOC(=O)C1(C)CC1(C)C
InChIInChI=1S/C8H14O2/c1-7(2)5-8(7,3)6(9)10-4/h5H2,1-4H3
InChIKeyBLPQCDFICQHLHX-UHFFFAOYSA-N
MW142.20 g/mol
LogP1.60
Rot. Bonds1

About methyl 1,2,2-trimethylcyclopropane-1-carboxylate

methyl 1,2,2-trimethylcyclopropane-1-carboxylate (PubChem CID 15129471) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is methyl 1,2,2-trimethylcyclopropane-1-carboxylate.

Molecular Properties

Compound Namemethyl 1,2,2-trimethylcyclopropane-1-carboxylate
PubChem CID15129471
Molecular FormulaC8H14O2
Molecular Weight142.20 g/mol
Exact Mass142.10
IUPAC Namemethyl 1,2,2-trimethylcyclopropane-1-carboxylate
SMILESCOC(=O)C1(C)CC1(C)C
InChIInChI=1S/C8H14O2/c1-7(2)5-8(7,3)6(9)10-4/h5H2,1-4H3
InChIKeyBLPQCDFICQHLHX-UHFFFAOYSA-N
XLogP1.60
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.20
LogP ≤ 51.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 1,2,2-trimethylcyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1,2,2-trimethylcyclopropane-1-carboxylate?
The IUPAC name of methyl 1,2,2-trimethylcyclopropane-1-carboxylate (CID 15129471) is methyl 1,2,2-trimethylcyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1,2,2-trimethylcyclopropane-1-carboxylate?
The canonical SMILES for methyl 1,2,2-trimethylcyclopropane-1-carboxylate is COC(=O)C1(C)CC1(C)C.
What is the InChIKey of methyl 1,2,2-trimethylcyclopropane-1-carboxylate?
The InChIKey is BLPQCDFICQHLHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-7(2)5-8(7,3)6(9)10-4/h5H2,1-4H3.
What are the key properties of methyl 1,2,2-trimethylcyclopropane-1-carboxylate?
methyl 1,2,2-trimethylcyclopropane-1-carboxylate has a molecular weight of 142.20 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,2,2-trimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 15129471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).