C9H14O4 — CID 115017052
1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid (PubChem CID 115017052) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid.
| Compound Name | 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115017052 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid |
| SMILES | COC(=O)C1(C(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C9H14O4/c1-8(2)4-9(5-8,6(10)11)7(12)13-3/h4-5H2,1-3H3,(H,10,11) |
| InChIKey | MQNVVFYTKUTCFE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|