1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid

C9H14O4 — CID 115017052

IUPAC1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid
SMILESCOC(=O)C1(C(=O)O)CC(C)(C)C1
InChIInChI=1S/C9H14O4/c1-8(2)4-9(5-8,6(10)11)7(12)13-3/h4-5H2,1-3H3,(H,10,11)
InChIKeyMQNVVFYTKUTCFE-UHFFFAOYSA-N
MW186.21 g/mol
LogP1.05
Rot. Bonds2

About 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid

1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid (PubChem CID 115017052) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid
PubChem CID115017052
Molecular FormulaC9H14O4
Molecular Weight186.21 g/mol
Exact Mass186.09
IUPAC Name1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid
SMILESCOC(=O)C1(C(=O)O)CC(C)(C)C1
InChIInChI=1S/C9H14O4/c1-8(2)4-9(5-8,6(10)11)7(12)13-3/h4-5H2,1-3H3,(H,10,11)
InChIKeyMQNVVFYTKUTCFE-UHFFFAOYSA-N
XLogP1.05
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.21
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid?
The IUPAC name of 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid (CID 115017052) is 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid?
The canonical SMILES for 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid is COC(=O)C1(C(=O)O)CC(C)(C)C1.
What is the InChIKey of 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid?
The InChIKey is MQNVVFYTKUTCFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-8(2)4-9(5-8,6(10)11)7(12)13-3/h4-5H2,1-3H3,(H,10,11).
What are the key properties of 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid?
1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid has a molecular weight of 186.21 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxycarbonyl-3,3-dimethylcyclobutane-1-carboxylic acid is sourced from PubChem (CID 115017052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).