C9H12O4 — CID 23423440
5-methoxycarbonylbicyclo[3.1.0]hexane-1-carboxylic acid (PubChem CID 23423440) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-methoxycarbonylbicyclo[3.1.0]hexane-1-carboxylic acid.
| Compound Name | 5-methoxycarbonylbicyclo[3.1.0]hexane-1-carboxylic acid |
|---|---|
| PubChem CID | 23423440 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5-methoxycarbonylbicyclo[3.1.0]hexane-1-carboxylic acid |
| SMILES | COC(=O)C12CCCC1(C(=O)O)C2 |
| InChI | InChI=1S/C9H12O4/c1-13-7(12)9-4-2-3-8(9,5-9)6(10)11/h2-5H2,1H3,(H,10,11) |
| InChIKey | AHQQVZSBPREFJH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |