C8H9ClO4 — CID 164907247
2-chloro-3-methoxycarbonylbicyclo[1.1.1]pentane-1-carboxylic acid (PubChem CID 164907247) has the molecular formula C8H9ClO4 and a molecular weight of 204.61 g/mol. Its IUPAC name is 2-chloro-3-methoxycarbonylbicyclo[1.1.1]pentane-1-carboxylic acid.
| Compound Name | 2-chloro-3-methoxycarbonylbicyclo[1.1.1]pentane-1-carboxylic acid |
|---|---|
| PubChem CID | 164907247 |
| Molecular Formula | C8H9ClO4 |
| Molecular Weight | 204.61 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2-chloro-3-methoxycarbonylbicyclo[1.1.1]pentane-1-carboxylic acid |
| SMILES | COC(=O)C12CC(C(=O)O)(C1)C2Cl |
| InChI | InChI=1S/C8H9ClO4/c1-13-6(12)8-2-7(3-8,4(8)9)5(10)11/h4H,2-3H2,1H3,(H,10,11) |
| InChIKey | VHYRHFMMPKWBAW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.61 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|