About dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate
dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate (PubChem CID 102319809) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate.
Analyze dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate?
The IUPAC name of dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate (CID 102319809) is dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate.
What is the SMILES notation for dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate?
The canonical SMILES for dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate is COC(=O)[C@@]12C[C@H]3C[C@@H]1C[C@@]3(C(=O)OC)C2.
What is the InChIKey of dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate?
The InChIKey is BCBJQXDWABQQEP-GAJNKVMBSA-N. The full InChI is InChI=1S/C12H16O4/c1-15-9(13)11-4-8-3-7(11)5-12(8,6-11)10(14)16-2/h7-8H,3-6H2,1-2H3/t7-,8-,11-,12-/m1/s1.
What are the key properties of dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate?
dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate has a molecular weight of 224.26 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (1R,3R,5R,7R)-tricyclo[3.3.0.03,7]octane-1,3-dicarboxylate is sourced from PubChem (CID 102319809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).