1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid

C8H9ClO6 — CID 139621478

IUPAC1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid
SMILESCOC(=O)C1(C(=O)OC)CC1(Cl)C(=O)O
InChIInChI=1S/C8H9ClO6/c1-14-5(12)7(6(13)15-2)3-8(7,9)4(10)11/h3H2,1-2H3,(H,10,11)
InChIKeyHMPBYWJOOFWSSQ-UHFFFAOYSA-N
MW236.61 g/mol
LogP-0.22
Rot. Bonds3

About 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid

1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid (PubChem CID 139621478) has the molecular formula C8H9ClO6 and a molecular weight of 236.61 g/mol. Its IUPAC name is 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid
PubChem CID139621478
Molecular FormulaC8H9ClO6
Molecular Weight236.61 g/mol
Exact Mass236.01
IUPAC Name1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid
SMILESCOC(=O)C1(C(=O)OC)CC1(Cl)C(=O)O
InChIInChI=1S/C8H9ClO6/c1-14-5(12)7(6(13)15-2)3-8(7,9)4(10)11/h3H2,1-2H3,(H,10,11)
InChIKeyHMPBYWJOOFWSSQ-UHFFFAOYSA-N
XLogP-0.22
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.61
LogP ≤ 5-0.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid?
The IUPAC name of 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid (CID 139621478) is 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid is COC(=O)C1(C(=O)OC)CC1(Cl)C(=O)O.
What is the InChIKey of 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid?
The InChIKey is HMPBYWJOOFWSSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO6/c1-14-5(12)7(6(13)15-2)3-8(7,9)4(10)11/h3H2,1-2H3,(H,10,11).
What are the key properties of 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid?
1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid has a molecular weight of 236.61 g/mol, XLogP of -0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,2-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 139621478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).