C6H6Cl2O4 — CID 130618268
cis-(1S,2R)-1,2-dichlorocyclobutane-1,2-dicarboxylic acid (PubChem CID 130618268) has the molecular formula C6H6Cl2O4 and a molecular weight of 213.02 g/mol. Its IUPAC name is cis-(1S,2R)-1,2-dichlorocyclobutane-1,2-dicarboxylic acid.
| Compound Name | cis-(1S,2R)-1,2-dichlorocyclobutane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 130618268 |
| Molecular Formula | C6H6Cl2O4 |
| Molecular Weight | 213.02 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | cis-(1S,2R)-1,2-dichlorocyclobutane-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@]1(Cl)CC[C@]1(Cl)C(=O)O |
| InChI | InChI=1S/C6H6Cl2O4/c7-5(3(9)10)1-2-6(5,8)4(11)12/h1-2H2,(H,9,10)(H,11,12)/t5-,6+ |
| InChIKey | NEQINKYOJBFOKP-OLQVQODUSA-N |
| XLogP | 0.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.02 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|