C6H6Cl2O4S — CID 154108044
2,3-dichlorothiolane-2,3-dicarboxylic acid (PubChem CID 154108044) has the molecular formula C6H6Cl2O4S and a molecular weight of 245.08 g/mol. Its IUPAC name is 2,3-dichlorothiolane-2,3-dicarboxylic acid.
| Compound Name | 2,3-dichlorothiolane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 154108044 |
| Molecular Formula | C6H6Cl2O4S |
| Molecular Weight | 245.08 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 2,3-dichlorothiolane-2,3-dicarboxylic acid |
| SMILES | O=C(O)C1(Cl)CCSC1(Cl)C(=O)O |
| InChI | InChI=1S/C6H6Cl2O4S/c7-5(3(9)10)1-2-13-6(5,8)4(11)12/h1-2H2,(H,9,10)(H,11,12) |
| InChIKey | MWDFHTPEHSUFMX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.08 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|