About (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid
(3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid (PubChem CID 22213519) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid.
Molecular Properties
| Compound Name | (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid |
| PubChem CID | 22213519 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid |
| SMILES | CC1(C)SCC[C@@]1(N)C(=O)O |
| InChI | InChI=1S/C7H13NO2S/c1-6(2)7(8,5(9)10)3-4-11-6/h3-4,8H2,1-2H3,(H,9,10)/t7-/m1/s1 |
| InChIKey | AWAQPYCGIRQIEV-SSDOTTSWSA-N |
| XLogP | 0.68 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid?
The IUPAC name of (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid (CID 22213519) is (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid.
What is the SMILES notation for (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid?
The canonical SMILES for (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid is CC1(C)SCC[C@@]1(N)C(=O)O.
What is the InChIKey of (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid?
The InChIKey is AWAQPYCGIRQIEV-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-6(2)7(8,5(9)10)3-4-11-6/h3-4,8H2,1-2H3,(H,9,10)/t7-/m1/s1.
What are the key properties of (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid?
(3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid has a molecular weight of 175.25 g/mol, XLogP of 0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid is sourced from PubChem (CID 22213519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).