(3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid

C7H13NO2S — CID 22213519

IUPAC(3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid
SMILESCC1(C)SCC[C@@]1(N)C(=O)O
InChIInChI=1S/C7H13NO2S/c1-6(2)7(8,5(9)10)3-4-11-6/h3-4,8H2,1-2H3,(H,9,10)/t7-/m1/s1
InChIKeyAWAQPYCGIRQIEV-SSDOTTSWSA-N
MW175.25 g/mol
LogP0.68
Rot. Bonds1

About (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid

(3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid (PubChem CID 22213519) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid.

Molecular Properties

Compound Name(3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid
PubChem CID22213519
Molecular FormulaC7H13NO2S
Molecular Weight175.25 g/mol
Exact Mass175.07
IUPAC Name(3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid
SMILESCC1(C)SCC[C@@]1(N)C(=O)O
InChIInChI=1S/C7H13NO2S/c1-6(2)7(8,5(9)10)3-4-11-6/h3-4,8H2,1-2H3,(H,9,10)/t7-/m1/s1
InChIKeyAWAQPYCGIRQIEV-SSDOTTSWSA-N
XLogP0.68
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.25
LogP ≤ 50.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid?
The IUPAC name of (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid (CID 22213519) is (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid.
What is the SMILES notation for (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid?
The canonical SMILES for (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid is CC1(C)SCC[C@@]1(N)C(=O)O.
What is the InChIKey of (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid?
The InChIKey is AWAQPYCGIRQIEV-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-6(2)7(8,5(9)10)3-4-11-6/h3-4,8H2,1-2H3,(H,9,10)/t7-/m1/s1.
What are the key properties of (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid?
(3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid has a molecular weight of 175.25 g/mol, XLogP of 0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-2,2-dimethylthiolane-3-carboxylic acid is sourced from PubChem (CID 22213519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).