C14H20O8 — CID 175458991
1,2,3,4-tetramethylcyclohexane-1,2,3,4-tetracarboxylic acid (PubChem CID 175458991) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1,2,3,4-tetramethylcyclohexane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 1,2,3,4-tetramethylcyclohexane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 175458991 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1,2,3,4-tetramethylcyclohexane-1,2,3,4-tetracarboxylic acid |
| SMILES | CC1(C(=O)O)CCC(C)(C(=O)O)C(C)(C(=O)O)C1(C)C(=O)O |
| InChI | InChI=1S/C14H20O8/c1-11(7(15)16)5-6-12(2,8(17)18)14(4,10(21)22)13(11,3)9(19)20/h5-6H2,1-4H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | PCQXUANYPKPWIN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |