C10H15BrO4 — CID 927623
trans-(1S,3S)-1-bromo-2,2,3-trimethylcyclopentane-1,3-dicarboxylic acid (PubChem CID 927623) has the molecular formula C10H15BrO4 and a molecular weight of 279.13 g/mol. Its IUPAC name is trans-(1S,3S)-1-bromo-2,2,3-trimethylcyclopentane-1,3-dicarboxylic acid.
| Compound Name | trans-(1S,3S)-1-bromo-2,2,3-trimethylcyclopentane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 927623 |
| Molecular Formula | C10H15BrO4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | trans-(1S,3S)-1-bromo-2,2,3-trimethylcyclopentane-1,3-dicarboxylic acid |
| SMILES | CC1(C)[C@](Br)(C(=O)O)CC[C@]1(C)C(=O)O |
| InChI | InChI=1S/C10H15BrO4/c1-8(2)9(3,6(12)13)4-5-10(8,11)7(14)15/h4-5H2,1-3H3,(H,12,13)(H,14,15)/t9-,10-/m1/s1 |
| InChIKey | MSIQRDVANPFESF-NXEZZACHSA-N |
| XLogP | 2.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|