3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid

C10H19NO2 — CID 102568279

IUPAC3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid
SMILESCC1(N)CCC(C)(C(=O)O)C1(C)C
InChIInChI=1S/C10H19NO2/c1-8(2)9(3,7(12)13)5-6-10(8,4)11/h5-6,11H2,1-4H3,(H,12,13)
InChIKeyXHQZLSSHEHQBBO-UHFFFAOYSA-N
MW185.27 g/mol
LogP1.61
Rot. Bonds1

About 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid

3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid (PubChem CID 102568279) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid
PubChem CID102568279
Molecular FormulaC10H19NO2
Molecular Weight185.27 g/mol
Exact Mass185.14
IUPAC Name3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid
SMILESCC1(N)CCC(C)(C(=O)O)C1(C)C
InChIInChI=1S/C10H19NO2/c1-8(2)9(3,7(12)13)5-6-10(8,4)11/h5-6,11H2,1-4H3,(H,12,13)
InChIKeyXHQZLSSHEHQBBO-UHFFFAOYSA-N
XLogP1.61
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.27
LogP ≤ 51.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid?
The IUPAC name of 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid (CID 102568279) is 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid?
The canonical SMILES for 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid is CC1(N)CCC(C)(C(=O)O)C1(C)C.
What is the InChIKey of 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid?
The InChIKey is XHQZLSSHEHQBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-8(2)9(3,7(12)13)5-6-10(8,4)11/h5-6,11H2,1-4H3,(H,12,13).
What are the key properties of 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid?
3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid has a molecular weight of 185.27 g/mol, XLogP of 1.61, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,2,2,3-tetramethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 102568279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).