1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid

C9H14O4 — CID 20525202

IUPAC1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid
SMILESCC1CC(C)(C(=O)O)C1(C)C(=O)O
InChIInChI=1S/C9H14O4/c1-5-4-8(2,6(10)11)9(5,3)7(12)13/h5H,4H2,1-3H3,(H,10,11)(H,12,13)
InChIKeyLGAWVLWWVIOMBL-UHFFFAOYSA-N
MW186.21 g/mol
LogP1.21
Rot. Bonds2

About 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid

1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid (PubChem CID 20525202) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid.

Molecular Properties

Compound Name1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid
PubChem CID20525202
Molecular FormulaC9H14O4
Molecular Weight186.21 g/mol
Exact Mass186.09
IUPAC Name1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid
SMILESCC1CC(C)(C(=O)O)C1(C)C(=O)O
InChIInChI=1S/C9H14O4/c1-5-4-8(2,6(10)11)9(5,3)7(12)13/h5H,4H2,1-3H3,(H,10,11)(H,12,13)
InChIKeyLGAWVLWWVIOMBL-UHFFFAOYSA-N
XLogP1.21
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.21
LogP ≤ 51.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid?
The IUPAC name of 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid (CID 20525202) is 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid.
What is the SMILES notation for 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid?
The canonical SMILES for 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid is CC1CC(C)(C(=O)O)C1(C)C(=O)O.
What is the InChIKey of 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid?
The InChIKey is LGAWVLWWVIOMBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-5-4-8(2,6(10)11)9(5,3)7(12)13/h5H,4H2,1-3H3,(H,10,11)(H,12,13).
What are the key properties of 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid?
1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid has a molecular weight of 186.21 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethylcyclobutane-1,2-dicarboxylic acid is sourced from PubChem (CID 20525202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).