C7H10Cl2O6 — CID 150771688
trans-(3S,5S)-3,5-dichloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid (PubChem CID 150771688) has the molecular formula C7H10Cl2O6 and a molecular weight of 261.06 g/mol. Its IUPAC name is trans-(3S,5S)-3,5-dichloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(3S,5S)-3,5-dichloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 150771688 |
| Molecular Formula | C7H10Cl2O6 |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | trans-(3S,5S)-3,5-dichloro-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(O)C[C@](O)(Cl)C(O)[C@@](O)(Cl)C1 |
| InChI | InChI=1S/C7H10Cl2O6/c8-6(14)1-5(13,4(11)12)2-7(9,15)3(6)10/h3,10,13-15H,1-2H2,(H,11,12)/t3?,5?,6-,7-/m1/s1 |
| InChIKey | JZZOBIYKLCOURW-OZRXJSIASA-N |
| XLogP | -1.19 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|