C8H9ClO6 — CID 139621458
1-chloro-2,3-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid (PubChem CID 139621458) has the molecular formula C8H9ClO6 and a molecular weight of 236.61 g/mol. Its IUPAC name is 1-chloro-2,3-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-chloro-2,3-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 139621458 |
| Molecular Formula | C8H9ClO6 |
| Molecular Weight | 236.61 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 1-chloro-2,3-bis(methoxycarbonyl)cyclopropane-1-carboxylic acid |
| SMILES | COC(=O)C1C(C(=O)OC)C1(Cl)C(=O)O |
| InChI | InChI=1S/C8H9ClO6/c1-14-5(10)3-4(6(11)15-2)8(3,9)7(12)13/h3-4H,1-2H3,(H,12,13) |
| InChIKey | PHSRONIVTJISKG-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.61 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|