About [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury
[(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury (PubChem CID 15074977) has the molecular formula C8H11ClHgO4
and a molecular weight of 407.22 g/mol. Its IUPAC name is [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury.
Molecular Properties
| Compound Name | [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury |
| PubChem CID | 15074977 |
| Molecular Formula | C8H11ClHgO4 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury |
| SMILES | COC(=O)[C@H]1[C@@H]([Hg]Cl)[C@@]1(C)OC(C)=O |
| InChI | InChI=1S/C8H11O4.ClH.Hg/c1-5(9)12-8(2)4-6(8)7(10)11-3;;/h4,6H,1-3H3;1H;/q;;+1/p-1/t6-,8-;;/m1../s1 |
| InChIKey | YPCGNLDPBRJDOD-QGTMZHJHSA-M |
| XLogP | 1.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury?
The IUPAC name of [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury (CID 15074977) is [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury.
What is the SMILES notation for [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury?
The canonical SMILES for [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury is COC(=O)[C@H]1[C@@H]([Hg]Cl)[C@@]1(C)OC(C)=O.
What is the InChIKey of [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury?
The InChIKey is YPCGNLDPBRJDOD-QGTMZHJHSA-M. The full InChI is InChI=1S/C8H11O4.ClH.Hg/c1-5(9)12-8(2)4-6(8)7(10)11-3;;/h4,6H,1-3H3;1H;/q;;+1/p-1/t6-,8-;;/m1../s1.
What are the key properties of [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury?
[(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury has a molecular weight of 407.22 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S,3S)-2-acetyloxy-3-methoxycarbonyl-2-methylcyclopropyl]-chloromercury is sourced from PubChem (CID 15074977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).