C7H9Cl2NO2 — CID 125425914
methyl (3R,6R)-2,2-dichloro-5-azaspiro[2.3]hexane-6-carboxylate (PubChem CID 125425914) has the molecular formula C7H9Cl2NO2 and a molecular weight of 210.06 g/mol. Its IUPAC name is methyl (3R,6R)-2,2-dichloro-5-azaspiro[2.3]hexane-6-carboxylate.
| Compound Name | methyl (3R,6R)-2,2-dichloro-5-azaspiro[2.3]hexane-6-carboxylate |
|---|---|
| PubChem CID | 125425914 |
| Molecular Formula | C7H9Cl2NO2 |
| Molecular Weight | 210.06 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | methyl (3R,6R)-2,2-dichloro-5-azaspiro[2.3]hexane-6-carboxylate |
| SMILES | COC(=O)[C@@H]1NC[C@]12CC2(Cl)Cl |
| InChI | InChI=1S/C7H9Cl2NO2/c1-12-5(11)4-6(3-10-4)2-7(6,8)9/h4,10H,2-3H2,1H3/t4-,6+/m0/s1 |
| InChIKey | OTZWPQBIEGJLER-UJURSFKZSA-N |
| XLogP | 0.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.06 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|