C11H19NO2 — CID 125425441
methyl (3S)-7-methyl-2-azaspiro[3.5]nonane-3-carboxylate (PubChem CID 125425441) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is methyl (3S)-7-methyl-2-azaspiro[3.5]nonane-3-carboxylate.
| Compound Name | methyl (3S)-7-methyl-2-azaspiro[3.5]nonane-3-carboxylate |
|---|---|
| PubChem CID | 125425441 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | methyl (3S)-7-methyl-2-azaspiro[3.5]nonane-3-carboxylate |
| SMILES | COC(=O)[C@H]1NCC12CCC(C)CC2 |
| InChI | InChI=1S/C11H19NO2/c1-8-3-5-11(6-4-8)7-12-9(11)10(13)14-2/h8-9,12H,3-7H2,1-2H3/t8?,9-,11?/m1/s1 |
| InChIKey | GVEHLUMRKWTNFW-INWMGODYSA-N |
| XLogP | 1.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |