About methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate
methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate (PubChem CID 10466322) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate.
Analyze methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate?
The IUPAC name of methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate (CID 10466322) is methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate.
What is the SMILES notation for methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate?
The canonical SMILES for methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate is COC(=O)C1COC2(CCC(C)CC2)OC1.
What is the InChIKey of methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate?
The InChIKey is KRFZDHASCNVFOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-9-3-5-12(6-4-9)15-7-10(8-16-12)11(13)14-2/h9-10H,3-8H2,1-2H3.
What are the key properties of methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate?
methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate has a molecular weight of 228.29 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-methyl-1,5-dioxaspiro[5.5]undecane-3-carboxylate is sourced from PubChem (CID 10466322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).