C21H22O4 — CID 137392124
methyl (3S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane-8-carboxylate (PubChem CID 137392124) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is methyl (3S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane-8-carboxylate.
| Compound Name | methyl (3S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane-8-carboxylate |
|---|---|
| PubChem CID | 137392124 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | methyl (3S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonane-8-carboxylate |
| SMILES | COC(=O)C1CCC2(C1)OC(c1ccccc1)[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/C21H22O4/c1-23-20(22)17-12-13-21(14-17)24-18(15-8-4-2-5-9-15)19(25-21)16-10-6-3-7-11-16/h2-11,17-19H,12-14H2,1H3/t17?,18-,19?,21?/m0/s1 |
| InChIKey | WKSVPLVFFZWDBT-PWWBFRNWSA-N |
| XLogP | 4.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |