C25H26O5 — CID 15433275
methyl (2S,3S,6S)-6-ethenyl-6-methyl-8-oxo-2,3-diphenyl-1,4-dioxaspiro[4.5]decane-7-carboxylate (PubChem CID 15433275) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl (2S,3S,6S)-6-ethenyl-6-methyl-8-oxo-2,3-diphenyl-1,4-dioxaspiro[4.5]decane-7-carboxylate.
| Compound Name | methyl (2S,3S,6S)-6-ethenyl-6-methyl-8-oxo-2,3-diphenyl-1,4-dioxaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 15433275 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | methyl (2S,3S,6S)-6-ethenyl-6-methyl-8-oxo-2,3-diphenyl-1,4-dioxaspiro[4.5]decane-7-carboxylate |
| SMILES | C=C[C@@]1(C)C(C(=O)OC)C(=O)CCC12O[C@@H](c1ccccc1)[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/C25H26O5/c1-4-24(2)20(23(27)28-3)19(26)15-16-25(24)29-21(17-11-7-5-8-12-17)22(30-25)18-13-9-6-10-14-18/h4-14,20-22H,1,15-16H2,2-3H3/t20?,21-,22-,24-/m0/s1 |
| InChIKey | RSAHBYSGDJEEAY-HVUHPCARSA-N |
| XLogP | 4.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|