C16H26O4 — CID 102007340
methyl 3,3,11,11-tetramethyl-9-methylidene-1,5-dioxaspiro[5.5]undecane-10-carboxylate (PubChem CID 102007340) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl 3,3,11,11-tetramethyl-9-methylidene-1,5-dioxaspiro[5.5]undecane-10-carboxylate.
| Compound Name | methyl 3,3,11,11-tetramethyl-9-methylidene-1,5-dioxaspiro[5.5]undecane-10-carboxylate |
|---|---|
| PubChem CID | 102007340 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl 3,3,11,11-tetramethyl-9-methylidene-1,5-dioxaspiro[5.5]undecane-10-carboxylate |
| SMILES | C=C1CCC2(OCC(C)(C)CO2)C(C)(C)C1C(=O)OC |
| InChI | InChI=1S/C16H26O4/c1-11-7-8-16(19-9-14(2,3)10-20-16)15(4,5)12(11)13(17)18-6/h12H,1,7-10H2,2-6H3 |
| InChIKey | OHWLORCJOJHQQO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|