C10H12F2O2 — CID 67880333
methyl 3-(2,2-difluorocyclopropylidene)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 67880333) has the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. Its IUPAC name is methyl 3-(2,2-difluorocyclopropylidene)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | methyl 3-(2,2-difluorocyclopropylidene)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 67880333 |
| Molecular Formula | C10H12F2O2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | methyl 3-(2,2-difluorocyclopropylidene)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1C(=C2CC2(F)F)C1(C)C |
| InChI | InChI=1S/C10H12F2O2/c1-9(2)6(5-4-10(5,11)12)7(9)8(13)14-3/h7H,4H2,1-3H3 |
| InChIKey | RRLBUMKSMMZRKT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|