About methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate
methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate (PubChem CID 3367709) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate.
Analyze methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate?
The IUPAC name of methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate (CID 3367709) is methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate.
What is the SMILES notation for methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate?
The canonical SMILES for methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate is COC(=O)C1CC(C)(C)N(O)C(C)(C)C1.
What is the InChIKey of methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate?
The InChIKey is MMMJKCJKQUNPKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-10(2)6-8(9(13)15-5)7-11(3,4)12(10)14/h8,14H,6-7H2,1-5H3.
What are the key properties of methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate?
methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate has a molecular weight of 215.29 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-hydroxy-2,2,6,6-tetramethylpiperidine-4-carboxylate is sourced from PubChem (CID 3367709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).