About 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride
1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride (PubChem CID 139244692) has the molecular formula C10H20ClNO3
and a molecular weight of 237.73 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride.
Analyze 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride?
The IUPAC name of 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride (CID 139244692) is 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride.
What is the SMILES notation for 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride?
The canonical SMILES for 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride is CC1(C)CC(C(=O)O)CC(C)(C)[NH+]1O.[Cl-].
What is the InChIKey of 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride?
The InChIKey is OXSRSGIJDWLMBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3.ClH/c1-9(2)5-7(8(12)13)6-10(3,4)11(9)14;/h7,14H,5-6H2,1-4H3,(H,12,13);1H.
What are the key properties of 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride?
1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride has a molecular weight of 237.73 g/mol, XLogP of -2.68, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylic acid chloride is sourced from PubChem (CID 139244692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).