C8H13NO3 — CID 97292714
methyl (3S)-4,4-dimethyl-2-oxopyrrolidine-3-carboxylate (PubChem CID 97292714) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is methyl (3S)-4,4-dimethyl-2-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3S)-4,4-dimethyl-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 97292714 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | methyl (3S)-4,4-dimethyl-2-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)NCC1(C)C |
| InChI | InChI=1S/C8H13NO3/c1-8(2)4-9-6(10)5(8)7(11)12-3/h5H,4H2,1-3H3,(H,9,10)/t5-/m0/s1 |
| InChIKey | MGHKZGVMYAFOPO-YFKPBYRVSA-N |
| XLogP | -0.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|