C9H15NO3 — CID 95986850
methyl (3R,4S)-2-oxo-4-propan-2-ylpyrrolidine-3-carboxylate (PubChem CID 95986850) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is methyl (3R,4S)-2-oxo-4-propan-2-ylpyrrolidine-3-carboxylate.
| Compound Name | methyl (3R,4S)-2-oxo-4-propan-2-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 95986850 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | methyl (3R,4S)-2-oxo-4-propan-2-ylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)NC[C@H]1C(C)C |
| InChI | InChI=1S/C9H15NO3/c1-5(2)6-4-10-8(11)7(6)9(12)13-3/h5-7H,4H2,1-3H3,(H,10,11)/t6-,7+/m0/s1 |
| InChIKey | HHZXWJIRZPILAN-NKWVEPMBSA-N |
| XLogP | 0.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|