C12H10ClF2NO3 — CID 134531876
methyl (3S,4R)-4-(4-chloro-2,6-difluorophenyl)-2-oxopyrrolidine-3-carboxylate (PubChem CID 134531876) has the molecular formula C12H10ClF2NO3 and a molecular weight of 289.67 g/mol. Its IUPAC name is methyl (3S,4R)-4-(4-chloro-2,6-difluorophenyl)-2-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4R)-4-(4-chloro-2,6-difluorophenyl)-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 134531876 |
| Molecular Formula | C12H10ClF2NO3 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | methyl (3S,4R)-4-(4-chloro-2,6-difluorophenyl)-2-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)NC[C@H]1c1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C12H10ClF2NO3/c1-19-12(18)10-6(4-16-11(10)17)9-7(14)2-5(13)3-8(9)15/h2-3,6,10H,4H2,1H3,(H,16,17)/t6-,10-/m0/s1 |
| InChIKey | VJRBOEOOLDGZKB-WKEGUHRASA-N |
| XLogP | 1.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|