C14H15F2NO4 — CID 142493746
ethyl (3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate (PubChem CID 142493746) has the molecular formula C14H15F2NO4 and a molecular weight of 299.27 g/mol. Its IUPAC name is ethyl (3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 142493746 |
| Molecular Formula | C14H15F2NO4 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | ethyl (3S,4R)-4-(2,6-difluoro-4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)NC[C@H]1c1c(F)cc(OC)cc1F |
| InChI | InChI=1S/C14H15F2NO4/c1-3-21-14(19)12-8(6-17-13(12)18)11-9(15)4-7(20-2)5-10(11)16/h4-5,8,12H,3,6H2,1-2H3,(H,17,18)/t8-,12-/m0/s1 |
| InChIKey | RTCZBDBFISQZPJ-UFBFGSQYSA-N |
| XLogP | 1.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|