C14H17NO5 — CID 170994003
ethyl 4-(3-hydroxy-4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate (PubChem CID 170994003) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is ethyl 4-(3-hydroxy-4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 4-(3-hydroxy-4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 170994003 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | ethyl 4-(3-hydroxy-4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)NCC1c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C14H17NO5/c1-3-20-14(18)12-9(7-15-13(12)17)8-4-5-11(19-2)10(16)6-8/h4-6,9,12,16H,3,7H2,1-2H3,(H,15,17) |
| InChIKey | SZTJADRPGNARNU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|