C11H13NO3S — CID 122583066
methyl (3S,4R)-4-(4-methylthiophen-2-yl)-2-oxopyrrolidine-3-carboxylate (PubChem CID 122583066) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is methyl (3S,4R)-4-(4-methylthiophen-2-yl)-2-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4R)-4-(4-methylthiophen-2-yl)-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 122583066 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | methyl (3S,4R)-4-(4-methylthiophen-2-yl)-2-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)NC[C@@H]1c1cc(C)cs1 |
| InChI | InChI=1S/C11H13NO3S/c1-6-3-8(16-5-6)7-4-12-10(13)9(7)11(14)15-2/h3,5,7,9H,4H2,1-2H3,(H,12,13)/t7-,9+/m1/s1 |
| InChIKey | QYFHPJSMSTUQMN-APPZFPTMSA-N |
| XLogP | 1.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|